C30H50OSi — CID 89432026
tri(propan-2-yl)-[(2E,6E,10E)-2,6,10-trimethyl-12-phenyldodeca-2,6,10-trienoxy]silane (PubChem CID 89432026) has the molecular formula C30H50OSi and a molecular weight of 454.82 g/mol. Its IUPAC name is tri(propan-2-yl)-[(2E,6E,10E)-2,6,10-trimethyl-12-phenyldodeca-2,6,10-trienoxy]silane.
| Compound Name | tri(propan-2-yl)-[(2E,6E,10E)-2,6,10-trimethyl-12-phenyldodeca-2,6,10-trienoxy]silane |
|---|---|
| PubChem CID | 89432026 |
| Molecular Formula | C30H50OSi |
| Molecular Weight | 454.82 g/mol |
| Exact Mass | 454.36 |
| IUPAC Name | tri(propan-2-yl)-[(2E,6E,10E)-2,6,10-trimethyl-12-phenyldodeca-2,6,10-trienoxy]silane |
| SMILES | C/C(=C\CC/C(C)=C/Cc1ccccc1)CC/C=C(\C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H50OSi/c1-24(2)32(25(3)4,26(5)6)31-23-29(9)18-14-16-27(7)15-13-17-28(8)21-22-30-19-11-10-12-20-30/h10-12,15,18-21,24-26H,13-14,16-17,22-23H2,1-9H3/b27-15+,28-21+,29-18+ |
| InChIKey | BNURPVDYIOSXOK-AMCVUYPJSA-N |
| XLogP | 9.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.82 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|