C21H30O — CID 53310712
(2E,6E,10E)-3,7,11-trimethyl-12-phenyldodeca-2,6,10-trien-1-ol (PubChem CID 53310712) has the molecular formula C21H30O and a molecular weight of 298.47 g/mol. Its IUPAC name is (2E,6E,10E)-3,7,11-trimethyl-12-phenyldodeca-2,6,10-trien-1-ol.
| Compound Name | (2E,6E,10E)-3,7,11-trimethyl-12-phenyldodeca-2,6,10-trien-1-ol |
|---|---|
| PubChem CID | 53310712 |
| Molecular Formula | C21H30O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | (2E,6E,10E)-3,7,11-trimethyl-12-phenyldodeca-2,6,10-trien-1-ol |
| SMILES | C/C(=C\CO)CC/C=C(\C)CC/C=C(\C)Cc1ccccc1 |
| InChI | InChI=1S/C21H30O/c1-18(9-7-11-19(2)15-16-22)10-8-12-20(3)17-21-13-5-4-6-14-21/h4-6,9,12-15,22H,7-8,10-11,16-17H2,1-3H3/b18-9+,19-15+,20-12+ |
| InChIKey | SOEXKUNUJWOCRZ-OSWOODOJSA-N |
| XLogP | 5.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|