C17H22O3 — CID 11265797
[(2E,6E)-8-hydroxy-2,6-dimethylocta-2,6-dienyl] benzoate (PubChem CID 11265797) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is [(2E,6E)-8-hydroxy-2,6-dimethylocta-2,6-dienyl] benzoate.
| Compound Name | [(2E,6E)-8-hydroxy-2,6-dimethylocta-2,6-dienyl] benzoate |
|---|---|
| PubChem CID | 11265797 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | [(2E,6E)-8-hydroxy-2,6-dimethylocta-2,6-dienyl] benzoate |
| SMILES | C/C(=C\CO)CC/C=C(\C)COC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H22O3/c1-14(11-12-18)7-6-8-15(2)13-20-17(19)16-9-4-3-5-10-16/h3-5,8-11,18H,6-7,12-13H2,1-2H3/b14-11+,15-8+ |
| InChIKey | NOEPKOONZSOOBT-GGQZXFEVSA-N |
| XLogP | 3.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|