C19H24O3 — CID 71325361
(3,7-dimethyl-10-oxodeca-2,6-dienyl) benzoate (PubChem CID 71325361) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is (3,7-dimethyl-10-oxodeca-2,6-dienyl) benzoate.
| Compound Name | (3,7-dimethyl-10-oxodeca-2,6-dienyl) benzoate |
|---|---|
| PubChem CID | 71325361 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (3,7-dimethyl-10-oxodeca-2,6-dienyl) benzoate |
| SMILES | CC(=CCCC(C)=CCOC(=O)c1ccccc1)CCC=O |
| InChI | InChI=1S/C19H24O3/c1-16(10-7-14-20)8-6-9-17(2)13-15-22-19(21)18-11-4-3-5-12-18/h3-5,8,11-14H,6-7,9-10,15H2,1-2H3 |
| InChIKey | MOSKWLLUTJXZCP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|