C23H29NO — CID 102400491
(2E,6E)-8-(2-benzylanilino)-3,7-dimethylocta-2,6-dien-1-ol (PubChem CID 102400491) has the molecular formula C23H29NO and a molecular weight of 335.49 g/mol. Its IUPAC name is (2E,6E)-8-(2-benzylanilino)-3,7-dimethylocta-2,6-dien-1-ol.
| Compound Name | (2E,6E)-8-(2-benzylanilino)-3,7-dimethylocta-2,6-dien-1-ol |
|---|---|
| PubChem CID | 102400491 |
| Molecular Formula | C23H29NO |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | (2E,6E)-8-(2-benzylanilino)-3,7-dimethylocta-2,6-dien-1-ol |
| SMILES | C/C(=C\CO)CC/C=C(\C)CNc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C23H29NO/c1-19(15-16-25)9-8-10-20(2)18-24-23-14-7-6-13-22(23)17-21-11-4-3-5-12-21/h3-7,10-15,24-25H,8-9,16-18H2,1-2H3/b19-15+,20-10+ |
| InChIKey | UPZWLCUMHDMRMO-VRGWLGSASA-N |
| XLogP | 5.35 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|