C21H40O4Si — CID 14805432
methyl (6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7,11-dimethyldodeca-6,10-dienoate (PubChem CID 14805432) has the molecular formula C21H40O4Si and a molecular weight of 384.63 g/mol. Its IUPAC name is methyl (6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7,11-dimethyldodeca-6,10-dienoate.
| Compound Name | methyl (6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7,11-dimethyldodeca-6,10-dienoate |
|---|---|
| PubChem CID | 14805432 |
| Molecular Formula | C21H40O4Si |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | methyl (6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7,11-dimethyldodeca-6,10-dienoate |
| SMILES | COC(=O)CC(O)CC/C=C(\C)CC/C=C(\C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40O4Si/c1-17(12-10-14-19(22)15-20(23)24-6)11-9-13-18(2)16-25-26(7,8)21(3,4)5/h12-13,19,22H,9-11,14-16H2,1-8H3/b17-12+,18-13+ |
| InChIKey | YEUHAQVIVFKGAI-PWDIZTEBSA-N |
| XLogP | 5.39 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|