C22H38O3Si — CID 102385619
methyl (2E,3E,5E,9E)-11-[tert-butyl(dimethyl)silyl]oxy-2-ethylidene-4,10-dimethylundeca-3,5,9-trienoate (PubChem CID 102385619) has the molecular formula C22H38O3Si and a molecular weight of 378.63 g/mol. Its IUPAC name is methyl (2E,3E,5E,9E)-11-[tert-butyl(dimethyl)silyl]oxy-2-ethylidene-4,10-dimethylundeca-3,5,9-trienoate.
| Compound Name | methyl (2E,3E,5E,9E)-11-[tert-butyl(dimethyl)silyl]oxy-2-ethylidene-4,10-dimethylundeca-3,5,9-trienoate |
|---|---|
| PubChem CID | 102385619 |
| Molecular Formula | C22H38O3Si |
| Molecular Weight | 378.63 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | methyl (2E,3E,5E,9E)-11-[tert-butyl(dimethyl)silyl]oxy-2-ethylidene-4,10-dimethylundeca-3,5,9-trienoate |
| SMILES | C/C=C(\C=C(C)\C=C\CC/C=C(\C)CO[Si](C)(C)C(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C22H38O3Si/c1-10-20(21(23)24-7)16-18(2)14-12-11-13-15-19(3)17-25-26(8,9)22(4,5)6/h10,12,14-16H,11,13,17H2,1-9H3/b14-12+,18-16+,19-15+,20-10+ |
| InChIKey | DTIJRZCPNPZVGU-RGSULTITSA-N |
| XLogP | 6.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.63 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|