C16H26O3 — CID 11277127
tert-butyl (2E,3E,5E)-2-ethylidene-9-hydroxy-4-methylnona-3,5-dienoate (PubChem CID 11277127) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is tert-butyl (2E,3E,5E)-2-ethylidene-9-hydroxy-4-methylnona-3,5-dienoate.
| Compound Name | tert-butyl (2E,3E,5E)-2-ethylidene-9-hydroxy-4-methylnona-3,5-dienoate |
|---|---|
| PubChem CID | 11277127 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | tert-butyl (2E,3E,5E)-2-ethylidene-9-hydroxy-4-methylnona-3,5-dienoate |
| SMILES | C/C=C(\C=C(C)\C=C\CCCO)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H26O3/c1-6-14(15(18)19-16(3,4)5)12-13(2)10-8-7-9-11-17/h6,8,10,12,17H,7,9,11H2,1-5H3/b10-8+,13-12+,14-6+ |
| InChIKey | LGYZRDVWZDVZLU-AWTMIWOVSA-N |
| XLogP | 3.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|