C12H20O3 — CID 54752703
tert-butyl (2E,4E)-6-hydroxy-2,4-dimethylhexa-2,4-dienoate (PubChem CID 54752703) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is tert-butyl (2E,4E)-6-hydroxy-2,4-dimethylhexa-2,4-dienoate.
| Compound Name | tert-butyl (2E,4E)-6-hydroxy-2,4-dimethylhexa-2,4-dienoate |
|---|---|
| PubChem CID | 54752703 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | tert-butyl (2E,4E)-6-hydroxy-2,4-dimethylhexa-2,4-dienoate |
| SMILES | CC(=C\CO)/C=C(\C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H20O3/c1-9(6-7-13)8-10(2)11(14)15-12(3,4)5/h6,8,13H,7H2,1-5H3/b9-6+,10-8+ |
| InChIKey | VXOILCWWNHINTG-OAMUUVBCSA-N |
| XLogP | 2.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|