C19H24N4O4S — CID 54752705
tert-butyl (2E,4E)-2,4-dimethyl-6-(1-phenyltetrazol-5-yl)sulfonylhexa-2,4-dienoate (PubChem CID 54752705) has the molecular formula C19H24N4O4S and a molecular weight of 404.49 g/mol. Its IUPAC name is tert-butyl (2E,4E)-2,4-dimethyl-6-(1-phenyltetrazol-5-yl)sulfonylhexa-2,4-dienoate.
| Compound Name | tert-butyl (2E,4E)-2,4-dimethyl-6-(1-phenyltetrazol-5-yl)sulfonylhexa-2,4-dienoate |
|---|---|
| PubChem CID | 54752705 |
| Molecular Formula | C19H24N4O4S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | tert-butyl (2E,4E)-2,4-dimethyl-6-(1-phenyltetrazol-5-yl)sulfonylhexa-2,4-dienoate |
| SMILES | CC(=C\CS(=O)(=O)c1nnnn1-c1ccccc1)/C=C(\C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H24N4O4S/c1-14(13-15(2)17(24)27-19(3,4)5)11-12-28(25,26)18-20-21-22-23(18)16-9-7-6-8-10-16/h6-11,13H,12H2,1-5H3/b14-11+,15-13+ |
| InChIKey | YRPJEPKJZIRMGU-KFWRFBQVSA-N |
| XLogP | 2.67 |
| TPSA | 104.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|