C13H16N4O3S — CID 50992481
3,3-dimethyl-1-(1-phenyltetrazol-5-yl)sulfonylbutan-2-one (PubChem CID 50992481) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is 3,3-dimethyl-1-(1-phenyltetrazol-5-yl)sulfonylbutan-2-one.
| Compound Name | 3,3-dimethyl-1-(1-phenyltetrazol-5-yl)sulfonylbutan-2-one |
|---|---|
| PubChem CID | 50992481 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 3,3-dimethyl-1-(1-phenyltetrazol-5-yl)sulfonylbutan-2-one |
| SMILES | CC(C)(C)C(=O)CS(=O)(=O)c1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C13H16N4O3S/c1-13(2,3)11(18)9-21(19,20)12-14-15-16-17(12)10-7-5-4-6-8-10/h4-8H,9H2,1-3H3 |
| InChIKey | WAVSQXIVGQWEJW-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 94.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |