C10H11N5O4S — CID 72722820
5-(3-nitropropylsulfonyl)-1-phenyltetrazole (PubChem CID 72722820) has the molecular formula C10H11N5O4S and a molecular weight of 297.30 g/mol. Its IUPAC name is 5-(3-nitropropylsulfonyl)-1-phenyltetrazole.
| Compound Name | 5-(3-nitropropylsulfonyl)-1-phenyltetrazole |
|---|---|
| PubChem CID | 72722820 |
| Molecular Formula | C10H11N5O4S |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 5-(3-nitropropylsulfonyl)-1-phenyltetrazole |
| SMILES | O=[N+]([O-])CCCS(=O)(=O)c1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C10H11N5O4S/c16-14(17)7-4-8-20(18,19)10-11-12-13-15(10)9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2 |
| InChIKey | NJQQEEVUMRDQTQ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|