C22H21N5O9S — CID 25228063
[(2S,3S,4S,5S)-4-acetyloxy-2-methyl-5-[(1-phenyltetrazol-5-yl)sulfonylmethyl]oxolan-3-yl] 4-nitrobenzoate (PubChem CID 25228063) has the molecular formula C22H21N5O9S and a molecular weight of 531.50 g/mol. Its IUPAC name is [(2S,3S,4S,5S)-4-acetyloxy-2-methyl-5-[(1-phenyltetrazol-5-yl)sulfonylmethyl]oxolan-3-yl] 4-nitrobenzoate.
| Compound Name | [(2S,3S,4S,5S)-4-acetyloxy-2-methyl-5-[(1-phenyltetrazol-5-yl)sulfonylmethyl]oxolan-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 25228063 |
| Molecular Formula | C22H21N5O9S |
| Molecular Weight | 531.50 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | [(2S,3S,4S,5S)-4-acetyloxy-2-methyl-5-[(1-phenyltetrazol-5-yl)sulfonylmethyl]oxolan-3-yl] 4-nitrobenzoate |
| SMILES | CC(=O)O[C@H]1[C@@H](OC(=O)c2ccc([N+](=O)[O-])cc2)[C@H](C)O[C@@H]1CS(=O)(=O)c1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C22H21N5O9S/c1-13-19(36-21(29)15-8-10-17(11-9-15)27(30)31)20(35-14(2)28)18(34-13)12-37(32,33)22-23-24-25-26(22)16-6-4-3-5-7-16/h3-11,13,18-20H,12H2,1-2H3/t13-,18+,19-,20+/m0/s1 |
| InChIKey | TZPHXTNSTBAVHS-LGWHJFRWSA-N |
| XLogP | 1.29 |
| TPSA | 182.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.50 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|