C21H25N5O11S — CID 59475524
[(3S,4S,6R)-3,4,5-triacetyloxy-6-[(1-phenyltetrazol-5-yl)sulfonylamino]oxan-2-yl]methyl acetate (PubChem CID 59475524) has the molecular formula C21H25N5O11S and a molecular weight of 555.52 g/mol. Its IUPAC name is [(3S,4S,6R)-3,4,5-triacetyloxy-6-[(1-phenyltetrazol-5-yl)sulfonylamino]oxan-2-yl]methyl acetate.
| Compound Name | [(3S,4S,6R)-3,4,5-triacetyloxy-6-[(1-phenyltetrazol-5-yl)sulfonylamino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 59475524 |
| Molecular Formula | C21H25N5O11S |
| Molecular Weight | 555.52 g/mol |
| Exact Mass | 555.13 |
| IUPAC Name | [(3S,4S,6R)-3,4,5-triacetyloxy-6-[(1-phenyltetrazol-5-yl)sulfonylamino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](NS(=O)(=O)c2nnnn2-c2ccccc2)C(OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H25N5O11S/c1-11(27)33-10-16-17(34-12(2)28)18(35-13(3)29)19(36-14(4)30)20(37-16)23-38(31,32)21-22-24-25-26(21)15-8-6-5-7-9-15/h5-9,16-20,23H,10H2,1-4H3/t16?,17-,18-,19?,20+/m0/s1 |
| InChIKey | JMQLFMBSEZOVHL-YODPDHEQSA-N |
| XLogP | -0.98 |
| TPSA | 204.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.52 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|