C22H24O9S — CID 163014254
[(2R,3R,4S,5R,6R)-3-acetyloxy-2-hydroxy-6-methyl-5-(4-methylphenyl)sulfonyloxyoxan-4-yl] benzoate (PubChem CID 163014254) has the molecular formula C22H24O9S and a molecular weight of 464.49 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3-acetyloxy-2-hydroxy-6-methyl-5-(4-methylphenyl)sulfonyloxyoxan-4-yl] benzoate.
| Compound Name | [(2R,3R,4S,5R,6R)-3-acetyloxy-2-hydroxy-6-methyl-5-(4-methylphenyl)sulfonyloxyoxan-4-yl] benzoate |
|---|---|
| PubChem CID | 163014254 |
| Molecular Formula | C22H24O9S |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3-acetyloxy-2-hydroxy-6-methyl-5-(4-methylphenyl)sulfonyloxyoxan-4-yl] benzoate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(=O)c2ccccc2)[C@H](OS(=O)(=O)c2ccc(C)cc2)[C@@H](C)O[C@H]1O |
| InChI | InChI=1S/C22H24O9S/c1-13-9-11-17(12-10-13)32(26,27)31-18-14(2)28-22(25)20(29-15(3)23)19(18)30-21(24)16-7-5-4-6-8-16/h4-12,14,18-20,22,25H,1-3H3/t14-,18-,19-,20-,22-/m1/s1 |
| InChIKey | ROKGBVORJSMZEJ-AXFVVHPYSA-N |
| XLogP | 1.96 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|