C19H20O8S — CID 171126760
[(3R,4S,5R,6R)-4,6-dihydroxy-5-(4-methylphenyl)sulfonyloxyoxan-3-yl] benzoate (PubChem CID 171126760) has the molecular formula C19H20O8S and a molecular weight of 408.43 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-4,6-dihydroxy-5-(4-methylphenyl)sulfonyloxyoxan-3-yl] benzoate.
| Compound Name | [(3R,4S,5R,6R)-4,6-dihydroxy-5-(4-methylphenyl)sulfonyloxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 171126760 |
| Molecular Formula | C19H20O8S |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | [(3R,4S,5R,6R)-4,6-dihydroxy-5-(4-methylphenyl)sulfonyloxyoxan-3-yl] benzoate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2[C@@H](O)[C@H](OC(=O)c3ccccc3)CO[C@H]2O)cc1 |
| InChI | InChI=1S/C19H20O8S/c1-12-7-9-14(10-8-12)28(23,24)27-17-16(20)15(11-25-19(17)22)26-18(21)13-5-3-2-4-6-13/h2-10,15-17,19-20,22H,11H2,1H3/t15-,16+,17-,19-/m1/s1 |
| InChIKey | UMKYLHYMSBOFBH-SFNKJDCFSA-N |
| XLogP | 1.00 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|