C12H16O7S — CID 171123879
[(2S,3S,4R,5R)-2,4,5-trihydroxyoxan-3-yl] 4-methylbenzenesulfonate (PubChem CID 171123879) has the molecular formula C12H16O7S and a molecular weight of 304.32 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-2,4,5-trihydroxyoxan-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,3S,4R,5R)-2,4,5-trihydroxyoxan-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 171123879 |
| Molecular Formula | C12H16O7S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | [(2S,3S,4R,5R)-2,4,5-trihydroxyoxan-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2[C@H](O)[C@H](O)CO[C@@H]2O)cc1 |
| InChI | InChI=1S/C12H16O7S/c1-7-2-4-8(5-3-7)20(16,17)19-11-10(14)9(13)6-18-12(11)15/h2-5,9-15H,6H2,1H3/t9-,10-,11+,12+/m1/s1 |
| InChIKey | KTKCEKRKHGDSSA-WYUUTHIRSA-N |
| XLogP | -0.86 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|