C21H22O9S — CID 171125107
[5-acetyloxy-2-hydroxy-4-(4-methylphenyl)sulfonyloxyoxan-3-yl] benzoate (PubChem CID 171125107) has the molecular formula C21H22O9S and a molecular weight of 450.47 g/mol. Its IUPAC name is [5-acetyloxy-2-hydroxy-4-(4-methylphenyl)sulfonyloxyoxan-3-yl] benzoate.
| Compound Name | [5-acetyloxy-2-hydroxy-4-(4-methylphenyl)sulfonyloxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 171125107 |
| Molecular Formula | C21H22O9S |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | [5-acetyloxy-2-hydroxy-4-(4-methylphenyl)sulfonyloxyoxan-3-yl] benzoate |
| SMILES | CC(=O)OC1COC(O)C(OC(=O)c2ccccc2)C1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H22O9S/c1-13-8-10-16(11-9-13)31(25,26)30-18-17(28-14(2)22)12-27-21(24)19(18)29-20(23)15-6-4-3-5-7-15/h3-11,17-19,21,24H,12H2,1-2H3 |
| InChIKey | RLABQQVZKVAPOJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|