C23H36O2Si — CID 101130049
tert-butyl (E,2E)-2-[[dimethyl(phenyl)silyl]methylidene]dec-3-enoate (PubChem CID 101130049) has the molecular formula C23H36O2Si and a molecular weight of 372.63 g/mol. Its IUPAC name is tert-butyl (E,2E)-2-[[dimethyl(phenyl)silyl]methylidene]dec-3-enoate.
| Compound Name | tert-butyl (E,2E)-2-[[dimethyl(phenyl)silyl]methylidene]dec-3-enoate |
|---|---|
| PubChem CID | 101130049 |
| Molecular Formula | C23H36O2Si |
| Molecular Weight | 372.63 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | tert-butyl (E,2E)-2-[[dimethyl(phenyl)silyl]methylidene]dec-3-enoate |
| SMILES | CCCCCC/C=C/C(=C\[Si](C)(C)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H36O2Si/c1-7-8-9-10-11-13-16-20(22(24)25-23(2,3)4)19-26(5,6)21-17-14-12-15-18-21/h12-19H,7-11H2,1-6H3/b16-13+,20-19+ |
| InChIKey | HHSVEQDAWSAKLV-ZMUVCXEASA-N |
| XLogP | 5.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.63 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|