C30H48O2Si — CID 11431309
[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (E,2Z)-2-(trimethylsilylmethylidene)dec-3-enoate (PubChem CID 11431309) has the molecular formula C30H48O2Si and a molecular weight of 468.80 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (E,2Z)-2-(trimethylsilylmethylidene)dec-3-enoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (E,2Z)-2-(trimethylsilylmethylidene)dec-3-enoate |
|---|---|
| PubChem CID | 11431309 |
| Molecular Formula | C30H48O2Si |
| Molecular Weight | 468.80 g/mol |
| Exact Mass | 468.34 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (E,2Z)-2-(trimethylsilylmethylidene)dec-3-enoate |
| SMILES | CCCCCC/C=C/C(=C/[Si](C)(C)C)C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C30H48O2Si/c1-8-9-10-11-12-14-17-25(23-33(5,6)7)29(31)32-28-22-24(2)20-21-27(28)30(3,4)26-18-15-13-16-19-26/h13-19,23-24,27-28H,8-12,20-22H2,1-7H3/b17-14+,25-23-/t24-,27-,28-/m1/s1 |
| InChIKey | DPKFHTISQGUXTI-OBODABIYSA-N |
| XLogP | 8.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.80 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|