C29H44O3 — CID 10094811
[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (E)-3-oxo-2-propyldec-7-enoate (PubChem CID 10094811) has the molecular formula C29H44O3 and a molecular weight of 440.67 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (E)-3-oxo-2-propyldec-7-enoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (E)-3-oxo-2-propyldec-7-enoate |
|---|---|
| PubChem CID | 10094811 |
| Molecular Formula | C29H44O3 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (E)-3-oxo-2-propyldec-7-enoate |
| SMILES | CC/C=C/CCCC(=O)C(CCC)C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C29H44O3/c1-6-8-9-10-14-18-26(30)24(15-7-2)28(31)32-27-21-22(3)19-20-25(27)29(4,5)23-16-12-11-13-17-23/h8-9,11-13,16-17,22,24-25,27H,6-7,10,14-15,18-21H2,1-5H3/b9-8+/t22-,24?,25-,27-/m1/s1 |
| InChIKey | XYFYJCXJNILJBM-VLMATJCDSA-N |
| XLogP | 7.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|