C20H27ClO3 — CID 10736626
[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloro-3-oxobutanoate (PubChem CID 10736626) has the molecular formula C20H27ClO3 and a molecular weight of 350.89 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloro-3-oxobutanoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloro-3-oxobutanoate |
|---|---|
| PubChem CID | 10736626 |
| Molecular Formula | C20H27ClO3 |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloro-3-oxobutanoate |
| SMILES | CC(=O)C(Cl)C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C20H27ClO3/c1-13-10-11-16(20(3,4)15-8-6-5-7-9-15)17(12-13)24-19(23)18(21)14(2)22/h5-9,13,16-18H,10-12H2,1-4H3/t13-,16-,17-,18?/m1/s1 |
| InChIKey | URWVOFZVSUQETL-CIYNHRHLSA-N |
| XLogP | 4.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|