C19H26O3 — CID 13141742
[5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-oxopropanoate (PubChem CID 13141742) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-oxopropanoate.
| Compound Name | [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-oxopropanoate |
|---|---|
| PubChem CID | 13141742 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-oxopropanoate |
| SMILES | CC(=O)C(=O)OC1CC(C)CCC1C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C19H26O3/c1-13-10-11-16(17(12-13)22-18(21)14(2)20)19(3,4)15-8-6-5-7-9-15/h5-9,13,16-17H,10-12H2,1-4H3 |
| InChIKey | AKMVQTFFJPXWFD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|