C22H30O3 — CID 102051706
[5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-oxocyclopentane-1-carboxylate (PubChem CID 102051706) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-oxocyclopentane-1-carboxylate.
| Compound Name | [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-oxocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 102051706 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-oxocyclopentane-1-carboxylate |
| SMILES | CC1CCC(C(C)(C)c2ccccc2)C(OC(=O)C2CCCC2=O)C1 |
| InChI | InChI=1S/C22H30O3/c1-15-12-13-18(22(2,3)16-8-5-4-6-9-16)20(14-15)25-21(24)17-10-7-11-19(17)23/h4-6,8-9,15,17-18,20H,7,10-14H2,1-3H3 |
| InChIKey | UZEASYZVIHUTSW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|