C18H23ClO3 — CID 101408696
[(1R,2R,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloro-2-oxoacetate (PubChem CID 101408696) has the molecular formula C18H23ClO3 and a molecular weight of 322.83 g/mol. Its IUPAC name is [(1R,2R,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloro-2-oxoacetate.
| Compound Name | [(1R,2R,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloro-2-oxoacetate |
|---|---|
| PubChem CID | 101408696 |
| Molecular Formula | C18H23ClO3 |
| Molecular Weight | 322.83 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | [(1R,2R,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloro-2-oxoacetate |
| SMILES | C[C@@H]1CC[C@H](C(C)(C)c2ccccc2)[C@H](OC(=O)C(=O)Cl)C1 |
| InChI | InChI=1S/C18H23ClO3/c1-12-9-10-14(15(11-12)22-17(21)16(19)20)18(2,3)13-7-5-4-6-8-13/h4-8,12,14-15H,9-11H2,1-3H3/t12-,14+,15-/m1/s1 |
| InChIKey | FLXPDPCZOUBGSC-VHDGCEQUSA-N |
| XLogP | 4.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.83 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|