C25H30O3 — CID 10762222
[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 3-phenyloxirane-2-carboxylate (PubChem CID 10762222) has the molecular formula C25H30O3 and a molecular weight of 378.51 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 3-phenyloxirane-2-carboxylate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 3-phenyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 10762222 |
| Molecular Formula | C25H30O3 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 3-phenyloxirane-2-carboxylate |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)c2ccccc2)[C@H](OC(=O)C2OC2c2ccccc2)C1 |
| InChI | InChI=1S/C25H30O3/c1-17-14-15-20(25(2,3)19-12-8-5-9-13-19)21(16-17)27-24(26)23-22(28-23)18-10-6-4-7-11-18/h4-13,17,20-23H,14-16H2,1-3H3/t17-,20-,21-,22?,23?/m1/s1 |
| InChIKey | CBPJMPYLRIDGLZ-QNNYPBFYSA-N |
| XLogP | 5.45 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|