C19H26O3 — CID 14288033
[5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] oxirane-2-carboxylate (PubChem CID 14288033) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] oxirane-2-carboxylate.
| Compound Name | [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] oxirane-2-carboxylate |
|---|---|
| PubChem CID | 14288033 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] oxirane-2-carboxylate |
| SMILES | CC1CCC(C(C)(C)c2ccccc2)C(OC(=O)C2CO2)C1 |
| InChI | InChI=1S/C19H26O3/c1-13-9-10-15(16(11-13)22-18(20)17-12-21-17)19(2,3)14-7-5-4-6-8-14/h4-8,13,15-17H,9-12H2,1-3H3 |
| InChIKey | YIHFFFXYXQDZGQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|