C19H28O2 — CID 57243297
[(1S)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] propanoate (PubChem CID 57243297) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is [(1S)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] propanoate.
| Compound Name | [(1S)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] propanoate |
|---|---|
| PubChem CID | 57243297 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | [(1S)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] propanoate |
| SMILES | CCC(=O)O[C@H]1CC(C)CCC1C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C19H28O2/c1-5-18(20)21-17-13-14(2)11-12-16(17)19(3,4)15-9-7-6-8-10-15/h6-10,14,16-17H,5,11-13H2,1-4H3/t14?,16?,17-/m0/s1 |
| InChIKey | QECAJEFVDRMNTF-PREGVCBESA-N |
| XLogP | 4.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |