C23H32O2 — CID 11824011
[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate (PubChem CID 11824011) has the molecular formula C23H32O2 and a molecular weight of 340.51 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 11824011 |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)c2ccccc2)[C@H](OC(=O)C[C@H]2C=CCC2)C1 |
| InChI | InChI=1S/C23H32O2/c1-17-13-14-20(23(2,3)19-11-5-4-6-12-19)21(15-17)25-22(24)16-18-9-7-8-10-18/h4-7,9,11-12,17-18,20-21H,8,10,13-16H2,1-3H3/t17-,18+,20-,21-/m1/s1 |
| InChIKey | YWQPMNYHNWOWPM-KOUHRCEDSA-N |
| XLogP | 5.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|