C20H31O5P — CID 135049705
[(2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-dimethoxyphosphorylacetate (PubChem CID 135049705) has the molecular formula C20H31O5P and a molecular weight of 382.44 g/mol. Its IUPAC name is [(2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-dimethoxyphosphorylacetate.
| Compound Name | [(2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-dimethoxyphosphorylacetate |
|---|---|
| PubChem CID | 135049705 |
| Molecular Formula | C20H31O5P |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | [(2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-dimethoxyphosphorylacetate |
| SMILES | COP(=O)(CC(=O)OC1C[C@H](C)CC[C@H]1C(C)(C)c1ccccc1)OC |
| InChI | InChI=1S/C20H31O5P/c1-15-11-12-17(20(2,3)16-9-7-6-8-10-16)18(13-15)25-19(21)14-26(22,23-4)24-5/h6-10,15,17-18H,11-14H2,1-5H3/t15-,17-,18?/m1/s1 |
| InChIKey | ASGMRAURJFEUIO-KOFGWKMWSA-N |
| XLogP | 4.80 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|