C19H32O — CID 155710062
ethane;2-(2-methoxy-4-methylcyclohexyl)propan-2-ylbenzene (PubChem CID 155710062) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is ethane;2-(2-methoxy-4-methylcyclohexyl)propan-2-ylbenzene.
| Compound Name | ethane;2-(2-methoxy-4-methylcyclohexyl)propan-2-ylbenzene |
|---|---|
| PubChem CID | 155710062 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | ethane;2-(2-methoxy-4-methylcyclohexyl)propan-2-ylbenzene |
| SMILES | CC.COC1CC(C)CCC1C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C17H26O.C2H6/c1-13-10-11-15(16(12-13)18-4)17(2,3)14-8-6-5-7-9-14;1-2/h5-9,13,15-16H,10-12H2,1-4H3;1-2H3 |
| InChIKey | MHOLFDIJRQDCDR-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |