C16H26O2 — CID 174940939
(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexan-1-ol;hydrate (PubChem CID 174940939) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is (1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexan-1-ol;hydrate.
| Compound Name | (1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexan-1-ol;hydrate |
|---|---|
| PubChem CID | 174940939 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexan-1-ol;hydrate |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)c2ccccc2)[C@H](O)C1.O |
| InChI | InChI=1S/C16H24O.H2O/c1-12-9-10-14(15(17)11-12)16(2,3)13-7-5-4-6-8-13;/h4-8,12,14-15,17H,9-11H2,1-3H3;1H2/t12-,14-,15-;/m1./s1 |
| InChIKey | XKQZKWNXMMVOKA-RVXAEUMZSA-N |
| XLogP | 2.94 |
| TPSA | 51.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |