C16H23Br — CID 46737239
2-[(1S,2S,4R)-2-bromo-4-methylcyclohexyl]propan-2-ylbenzene (PubChem CID 46737239) has the molecular formula C16H23Br and a molecular weight of 295.26 g/mol. Its IUPAC name is 2-[(1S,2S,4R)-2-bromo-4-methylcyclohexyl]propan-2-ylbenzene.
| Compound Name | 2-[(1S,2S,4R)-2-bromo-4-methylcyclohexyl]propan-2-ylbenzene |
|---|---|
| PubChem CID | 46737239 |
| Molecular Formula | C16H23Br |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-[(1S,2S,4R)-2-bromo-4-methylcyclohexyl]propan-2-ylbenzene |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)c2ccccc2)[C@@H](Br)C1 |
| InChI | InChI=1S/C16H23Br/c1-12-9-10-14(15(17)11-12)16(2,3)13-7-5-4-6-8-13/h4-8,12,14-15H,9-11H2,1-3H3/t12-,14-,15+/m1/s1 |
| InChIKey | PSTLKECINDDKAX-YUELXQCFSA-N |
| XLogP | 5.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|