C17H25ClO3 — CID 86756445
carbonochloridic acid;5-methyl-2-(2-phenylpropan-2-yl)cyclohexan-1-ol (PubChem CID 86756445) has the molecular formula C17H25ClO3 and a molecular weight of 312.84 g/mol. Its IUPAC name is carbonochloridic acid;5-methyl-2-(2-phenylpropan-2-yl)cyclohexan-1-ol.
| Compound Name | carbonochloridic acid;5-methyl-2-(2-phenylpropan-2-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 86756445 |
| Molecular Formula | C17H25ClO3 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | carbonochloridic acid;5-methyl-2-(2-phenylpropan-2-yl)cyclohexan-1-ol |
| SMILES | CC1CCC(C(C)(C)c2ccccc2)C(O)C1.O=C(O)Cl |
| InChI | InChI=1S/C16H24O.CHClO2/c1-12-9-10-14(15(17)11-12)16(2,3)13-7-5-4-6-8-13;2-1(3)4/h4-8,12,14-15,17H,9-11H2,1-3H3;(H,3,4) |
| InChIKey | IGGWDSZJTAPFMP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|