C17H26 — CID 134857032
2-(2,4-dimethylcyclohexyl)propan-2-ylbenzene (PubChem CID 134857032) has the molecular formula C17H26 and a molecular weight of 230.40 g/mol. Its IUPAC name is 2-(2,4-dimethylcyclohexyl)propan-2-ylbenzene.
| Compound Name | 2-(2,4-dimethylcyclohexyl)propan-2-ylbenzene |
|---|---|
| PubChem CID | 134857032 |
| Molecular Formula | C17H26 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 2-(2,4-dimethylcyclohexyl)propan-2-ylbenzene |
| SMILES | CC1CCC(C(C)(C)c2ccccc2)C(C)C1 |
| InChI | InChI=1S/C17H26/c1-13-10-11-16(14(2)12-13)17(3,4)15-8-6-5-7-9-15/h5-9,13-14,16H,10-12H2,1-4H3 |
| InChIKey | PNHZYHPLDUGAPO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |