C21H27- — CID 134973601
2-[(1R,2R,4R)-2-cyclopenta-1,3-dien-1-yl-4-methylcyclohexyl]propan-2-ylbenzene (PubChem CID 134973601) has the molecular formula C21H27- and a molecular weight of 279.45 g/mol. Its IUPAC name is 2-[(1R,2R,4R)-2-cyclopenta-1,3-dien-1-yl-4-methylcyclohexyl]propan-2-ylbenzene.
| Compound Name | 2-[(1R,2R,4R)-2-cyclopenta-1,3-dien-1-yl-4-methylcyclohexyl]propan-2-ylbenzene |
|---|---|
| PubChem CID | 134973601 |
| Molecular Formula | C21H27- |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.21 |
| IUPAC Name | 2-[(1R,2R,4R)-2-cyclopenta-1,3-dien-1-yl-4-methylcyclohexyl]propan-2-ylbenzene |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)c2ccccc2)[C@H](c2ccc[cH-]2)C1 |
| InChI | InChI=1S/C21H27/c1-16-13-14-20(19(15-16)17-9-7-8-10-17)21(2,3)18-11-5-4-6-12-18/h4-12,16,19-20H,13-15H2,1-3H3/q-1/t16-,19+,20-/m1/s1 |
| InChIKey | ASFWKQHQYIZKDT-LSTHTHJFSA-N |
| XLogP | 5.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|