C25H28O — CID 11273869
[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl]-(3-phenylprop-2-ynylidene)oxidanium (PubChem CID 11273869) has the molecular formula C25H28O and a molecular weight of 344.50 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl]-(3-phenylprop-2-ynylidene)oxidanium.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl]-(3-phenylprop-2-ynylidene)oxidanium |
|---|---|
| PubChem CID | 11273869 |
| Molecular Formula | C25H28O |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl]-(3-phenylprop-2-ynylidene)oxidanium |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)c2ccccc2)[C@H](/[O+]=[C-]/C#Cc2ccccc2)C1 |
| InChI | InChI=1S/C25H28O/c1-20-16-17-23(25(2,3)22-14-8-5-9-15-22)24(19-20)26-18-10-13-21-11-6-4-7-12-21/h4-9,11-12,14-15,20,23-24H,16-17,19H2,1-3H3/t20-,23-,24-/m1/s1 |
| InChIKey | IWEPZTNTLPSCSG-AGILITTLSA-N |
| XLogP | 5.47 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|