C17H25Cl3O — CID 70236087
chloroform;5-methyl-2-(2-phenylpropan-2-yl)cyclohexan-1-ol (PubChem CID 70236087) has the molecular formula C17H25Cl3O and a molecular weight of 351.75 g/mol. Its IUPAC name is chloroform;5-methyl-2-(2-phenylpropan-2-yl)cyclohexan-1-ol.
| Compound Name | chloroform;5-methyl-2-(2-phenylpropan-2-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 70236087 |
| Molecular Formula | C17H25Cl3O |
| Molecular Weight | 351.75 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | chloroform;5-methyl-2-(2-phenylpropan-2-yl)cyclohexan-1-ol |
| SMILES | CC1CCC(C(C)(C)c2ccccc2)C(O)C1.ClC(Cl)Cl |
| InChI | InChI=1S/C16H24O.CHCl3/c1-12-9-10-14(15(17)11-12)16(2,3)13-7-5-4-6-8-13;2-1(3)4/h4-8,12,14-15,17H,9-11H2,1-3H3;1H |
| InChIKey | ZCWDJWSHKBANAF-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.75 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|