C18H25NO3 — CID 177398917
[(1S,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2E)-2-hydroxyiminoacetate (PubChem CID 177398917) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is [(1S,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2E)-2-hydroxyiminoacetate.
| Compound Name | [(1S,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2E)-2-hydroxyiminoacetate |
|---|---|
| PubChem CID | 177398917 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | [(1S,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2E)-2-hydroxyiminoacetate |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)c2ccccc2)[C@@H](OC(=O)/C=N/O)C1 |
| InChI | InChI=1S/C18H25NO3/c1-13-9-10-15(16(11-13)22-17(20)12-19-21)18(2,3)14-7-5-4-6-8-14/h4-8,12-13,15-16,21H,9-11H2,1-3H3/b19-12+/t13-,15-,16+/m1/s1 |
| InChIKey | PBVPKBZAWDTQFU-YWZQKXCESA-N |
| XLogP | 3.77 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|