C30H38O2 — CID 11037397
[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-(4-phenylcyclohexylidene)acetate (PubChem CID 11037397) has the molecular formula C30H38O2 and a molecular weight of 430.63 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-(4-phenylcyclohexylidene)acetate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-(4-phenylcyclohexylidene)acetate |
|---|---|
| PubChem CID | 11037397 |
| Molecular Formula | C30H38O2 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-(4-phenylcyclohexylidene)acetate |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)c2ccccc2)[C@H](OC(=O)C=C2CCC(c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C30H38O2/c1-22-14-19-27(30(2,3)26-12-8-5-9-13-26)28(20-22)32-29(31)21-23-15-17-25(18-16-23)24-10-6-4-7-11-24/h4-13,21-22,25,27-28H,14-20H2,1-3H3/b23-21-/t22-,25?,27-,28-/m1/s1 |
| InChIKey | WMUKUKOMBVNLPG-HQOHWZOFSA-N |
| XLogP | 7.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|