C21H27Cl3O3 — CID 10478008
[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 4,4,4-trichloro-3-hydroxy-2-methylidenebutanoate (PubChem CID 10478008) has the molecular formula C21H27Cl3O3 and a molecular weight of 433.80 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 4,4,4-trichloro-3-hydroxy-2-methylidenebutanoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 4,4,4-trichloro-3-hydroxy-2-methylidenebutanoate |
|---|---|
| PubChem CID | 10478008 |
| Molecular Formula | C21H27Cl3O3 |
| Molecular Weight | 433.80 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 4,4,4-trichloro-3-hydroxy-2-methylidenebutanoate |
| SMILES | C=C(C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)(C)c1ccccc1)C(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C21H27Cl3O3/c1-13-10-11-16(20(3,4)15-8-6-5-7-9-15)17(12-13)27-19(26)14(2)18(25)21(22,23)24/h5-9,13,16-18,25H,2,10-12H2,1,3-4H3/t13-,16-,17-,18?/m1/s1 |
| InChIKey | PVJCBZMBSJUEIF-CIYNHRHLSA-N |
| XLogP | 5.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.80 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|