About tert-butyl 2-benzylidenedecanoate
tert-butyl 2-benzylidenedecanoate (PubChem CID 150110674) has the molecular formula C21H32O2
and a molecular weight of 316.49 g/mol. Its IUPAC name is tert-butyl 2-benzylidenedecanoate.
Molecular Properties
| Compound Name | tert-butyl 2-benzylidenedecanoate |
| PubChem CID | 150110674 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | tert-butyl 2-benzylidenedecanoate |
| SMILES | CCCCCCCCC(=Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H32O2/c1-5-6-7-8-9-13-16-19(20(22)23-21(2,3)4)17-18-14-11-10-12-15-18/h10-12,14-15,17H,5-9,13,16H2,1-4H3 |
| InChIKey | DXELRVPHJKDJPT-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-benzylidenedecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-benzylidenedecanoate?
The IUPAC name of tert-butyl 2-benzylidenedecanoate (CID 150110674) is tert-butyl 2-benzylidenedecanoate.
What is the SMILES notation for tert-butyl 2-benzylidenedecanoate?
The canonical SMILES for tert-butyl 2-benzylidenedecanoate is CCCCCCCCC(=Cc1ccccc1)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-benzylidenedecanoate?
The InChIKey is DXELRVPHJKDJPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32O2/c1-5-6-7-8-9-13-16-19(20(22)23-21(2,3)4)17-18-14-11-10-12-15-18/h10-12,14-15,17H,5-9,13,16H2,1-4H3.
What are the key properties of tert-butyl 2-benzylidenedecanoate?
tert-butyl 2-benzylidenedecanoate has a molecular weight of 316.49 g/mol, XLogP of 6.16, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-benzylidenedecanoate is sourced from PubChem (CID 150110674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).