C17H22O4 — CID 101050979
tert-butyl (2Z)-2-benzylidene-6-hydroxy-3-oxohexanoate (PubChem CID 101050979) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is tert-butyl (2Z)-2-benzylidene-6-hydroxy-3-oxohexanoate.
| Compound Name | tert-butyl (2Z)-2-benzylidene-6-hydroxy-3-oxohexanoate |
|---|---|
| PubChem CID | 101050979 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | tert-butyl (2Z)-2-benzylidene-6-hydroxy-3-oxohexanoate |
| SMILES | CC(C)(C)OC(=O)/C(=C\c1ccccc1)C(=O)CCCO |
| InChI | InChI=1S/C17H22O4/c1-17(2,3)21-16(20)14(15(19)10-7-11-18)12-13-8-5-4-6-9-13/h4-6,8-9,12,18H,7,10-11H2,1-3H3/b14-12- |
| InChIKey | VMYXTQJFYFXYKT-OWBHPGMISA-N |
| XLogP | 2.75 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|