C18H25NO4 — CID 89047288
ditert-butyl 2-[(4-aminophenyl)methylidene]propanedioate (PubChem CID 89047288) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is ditert-butyl 2-[(4-aminophenyl)methylidene]propanedioate.
| Compound Name | ditert-butyl 2-[(4-aminophenyl)methylidene]propanedioate |
|---|---|
| PubChem CID | 89047288 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | ditert-butyl 2-[(4-aminophenyl)methylidene]propanedioate |
| SMILES | CC(C)(C)OC(=O)C(=Cc1ccc(N)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H25NO4/c1-17(2,3)22-15(20)14(16(21)23-18(4,5)6)11-12-7-9-13(19)10-8-12/h7-11H,19H2,1-6H3 |
| InChIKey | JXOSXBGPVJCJAE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|