C17H25NO2 — CID 160941149
tert-butyl (E,4S)-5-(4-aminophenyl)-2,4-dimethylpent-2-enoate (PubChem CID 160941149) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is tert-butyl (E,4S)-5-(4-aminophenyl)-2,4-dimethylpent-2-enoate.
| Compound Name | tert-butyl (E,4S)-5-(4-aminophenyl)-2,4-dimethylpent-2-enoate |
|---|---|
| PubChem CID | 160941149 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | tert-butyl (E,4S)-5-(4-aminophenyl)-2,4-dimethylpent-2-enoate |
| SMILES | C/C(=C\[C@@H](C)Cc1ccc(N)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H25NO2/c1-12(11-14-6-8-15(18)9-7-14)10-13(2)16(19)20-17(3,4)5/h6-10,12H,11,18H2,1-5H3/b13-10+/t12-/m1/s1 |
| InChIKey | SUNHENIAMLQXAH-GMCKNXKJSA-N |
| XLogP | 3.74 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|