C13H20N2O2 — CID 67217930
[1-(4-aminophenyl)-3,3-dimethylbutan-2-yl] carbamate (PubChem CID 67217930) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is [1-(4-aminophenyl)-3,3-dimethylbutan-2-yl] carbamate.
| Compound Name | [1-(4-aminophenyl)-3,3-dimethylbutan-2-yl] carbamate |
|---|---|
| PubChem CID | 67217930 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | [1-(4-aminophenyl)-3,3-dimethylbutan-2-yl] carbamate |
| SMILES | CC(C)(C)C(Cc1ccc(N)cc1)OC(N)=O |
| InChI | InChI=1S/C13H20N2O2/c1-13(2,3)11(17-12(15)16)8-9-4-6-10(14)7-5-9/h4-7,11H,8,14H2,1-3H3,(H2,15,16) |
| InChIKey | MPVDMZFTDRLDQR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|