About (1-amino-4,4-dimethylpentan-3-yl) carbamate;hydrochloride
(1-amino-4,4-dimethylpentan-3-yl) carbamate;hydrochloride (PubChem CID 140664667) has the molecular formula C8H19ClN2O2
and a molecular weight of 210.70 g/mol. Its IUPAC name is (1-amino-4,4-dimethylpentan-3-yl) carbamate;hydrochloride.
Molecular Properties
| Compound Name | (1-amino-4,4-dimethylpentan-3-yl) carbamate;hydrochloride |
| PubChem CID | 140664667 |
| Molecular Formula | C8H19ClN2O2 |
| Molecular Weight | 210.70 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | (1-amino-4,4-dimethylpentan-3-yl) carbamate;hydrochloride |
| SMILES | CC(C)(C)C(CCN)OC(N)=O.Cl |
| InChI | InChI=1S/C8H18N2O2.ClH/c1-8(2,3)6(4-5-9)12-7(10)11;/h6H,4-5,9H2,1-3H3,(H2,10,11);1H |
| InChIKey | OQPJWMKUDJRGSC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.70 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-amino-4,4-dimethylpentan-3-yl) carbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-amino-4,4-dimethylpentan-3-yl) carbamate;hydrochloride?
The IUPAC name of (1-amino-4,4-dimethylpentan-3-yl) carbamate;hydrochloride (CID 140664667) is (1-amino-4,4-dimethylpentan-3-yl) carbamate;hydrochloride.
What is the SMILES notation for (1-amino-4,4-dimethylpentan-3-yl) carbamate;hydrochloride?
The canonical SMILES for (1-amino-4,4-dimethylpentan-3-yl) carbamate;hydrochloride is CC(C)(C)C(CCN)OC(N)=O.Cl.
What is the InChIKey of (1-amino-4,4-dimethylpentan-3-yl) carbamate;hydrochloride?
The InChIKey is OQPJWMKUDJRGSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O2.ClH/c1-8(2,3)6(4-5-9)12-7(10)11;/h6H,4-5,9H2,1-3H3,(H2,10,11);1H.
What are the key properties of (1-amino-4,4-dimethylpentan-3-yl) carbamate;hydrochloride?
(1-amino-4,4-dimethylpentan-3-yl) carbamate;hydrochloride has a molecular weight of 210.70 g/mol, XLogP of 1.27, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-amino-4,4-dimethylpentan-3-yl) carbamate;hydrochloride is sourced from PubChem (CID 140664667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).