About [(2S)-3-tert-butyl-3-carbamoyloxy-1-hydroxy-4,4-dimethylpentan-2-yl] carbamate
[(2S)-3-tert-butyl-3-carbamoyloxy-1-hydroxy-4,4-dimethylpentan-2-yl] carbamate (PubChem CID 91312567) has the molecular formula C13H26N2O5
and a molecular weight of 290.36 g/mol. Its IUPAC name is [(2S)-3-tert-butyl-3-carbamoyloxy-1-hydroxy-4,4-dimethylpentan-2-yl] carbamate.
Molecular Properties
| Compound Name | [(2S)-3-tert-butyl-3-carbamoyloxy-1-hydroxy-4,4-dimethylpentan-2-yl] carbamate |
| PubChem CID | 91312567 |
| Molecular Formula | C13H26N2O5 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | [(2S)-3-tert-butyl-3-carbamoyloxy-1-hydroxy-4,4-dimethylpentan-2-yl] carbamate |
| SMILES | CC(C)(C)C(OC(N)=O)([C@H](CO)OC(N)=O)C(C)(C)C |
| InChI | InChI=1S/C13H26N2O5/c1-11(2,3)13(12(4,5)6,20-10(15)18)8(7-16)19-9(14)17/h8,16H,7H2,1-6H3,(H2,14,17)(H2,15,18)/t8-/m0/s1 |
| InChIKey | BEYZHOMSZOMZMH-QMMMGPOBSA-N |
| XLogP | 1.37 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2S)-3-tert-butyl-3-carbamoyloxy-1-hydroxy-4,4-dimethylpentan-2-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-3-tert-butyl-3-carbamoyloxy-1-hydroxy-4,4-dimethylpentan-2-yl] carbamate?
The IUPAC name of [(2S)-3-tert-butyl-3-carbamoyloxy-1-hydroxy-4,4-dimethylpentan-2-yl] carbamate (CID 91312567) is [(2S)-3-tert-butyl-3-carbamoyloxy-1-hydroxy-4,4-dimethylpentan-2-yl] carbamate.
What is the SMILES notation for [(2S)-3-tert-butyl-3-carbamoyloxy-1-hydroxy-4,4-dimethylpentan-2-yl] carbamate?
The canonical SMILES for [(2S)-3-tert-butyl-3-carbamoyloxy-1-hydroxy-4,4-dimethylpentan-2-yl] carbamate is CC(C)(C)C(OC(N)=O)([C@H](CO)OC(N)=O)C(C)(C)C.
What is the InChIKey of [(2S)-3-tert-butyl-3-carbamoyloxy-1-hydroxy-4,4-dimethylpentan-2-yl] carbamate?
The InChIKey is BEYZHOMSZOMZMH-QMMMGPOBSA-N. The full InChI is InChI=1S/C13H26N2O5/c1-11(2,3)13(12(4,5)6,20-10(15)18)8(7-16)19-9(14)17/h8,16H,7H2,1-6H3,(H2,14,17)(H2,15,18)/t8-/m0/s1.
What are the key properties of [(2S)-3-tert-butyl-3-carbamoyloxy-1-hydroxy-4,4-dimethylpentan-2-yl] carbamate?
[(2S)-3-tert-butyl-3-carbamoyloxy-1-hydroxy-4,4-dimethylpentan-2-yl] carbamate has a molecular weight of 290.36 g/mol, XLogP of 1.37, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-3-tert-butyl-3-carbamoyloxy-1-hydroxy-4,4-dimethylpentan-2-yl] carbamate is sourced from PubChem (CID 91312567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).