C8H17NO3 — CID 87120669
[(2S)-1-hydroxy-4,4-dimethylpentan-2-yl] carbamate (PubChem CID 87120669) has the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. Its IUPAC name is [(2S)-1-hydroxy-4,4-dimethylpentan-2-yl] carbamate.
| Compound Name | [(2S)-1-hydroxy-4,4-dimethylpentan-2-yl] carbamate |
|---|---|
| PubChem CID | 87120669 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | [(2S)-1-hydroxy-4,4-dimethylpentan-2-yl] carbamate |
| SMILES | CC(C)(C)C[C@@H](CO)OC(N)=O |
| InChI | InChI=1S/C8H17NO3/c1-8(2,3)4-6(5-10)12-7(9)11/h6,10H,4-5H2,1-3H3,(H2,9,11)/t6-/m0/s1 |
| InChIKey | NOPMDSPMBLWBER-LURJTMIESA-N |
| XLogP | 0.88 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |