C7H14N2O5 — CID 161039387
(1-carbamoyloxy-3-hydroxy-2,2-dimethylpropyl) carbamate (PubChem CID 161039387) has the molecular formula C7H14N2O5 and a molecular weight of 206.20 g/mol. Its IUPAC name is (1-carbamoyloxy-3-hydroxy-2,2-dimethylpropyl) carbamate.
| Compound Name | (1-carbamoyloxy-3-hydroxy-2,2-dimethylpropyl) carbamate |
|---|---|
| PubChem CID | 161039387 |
| Molecular Formula | C7H14N2O5 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (1-carbamoyloxy-3-hydroxy-2,2-dimethylpropyl) carbamate |
| SMILES | CC(C)(CO)C(OC(N)=O)OC(N)=O |
| InChI | InChI=1S/C7H14N2O5/c1-7(2,3-10)4(13-5(8)11)14-6(9)12/h4,10H,3H2,1-2H3,(H2,8,11)(H2,9,12) |
| InChIKey | UARKYTPYQNBPIW-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|